C20H20F3N7O3 — CID 121358115
(9S)-8-N-(4-carbamoyl-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121358115) has the molecular formula C20H20F3N7O3 and a molecular weight of 463.42 g/mol. Its IUPAC name is (9S)-8-N-(4-carbamoyl-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-(4-carbamoyl-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121358115 |
| Molecular Formula | C20H20F3N7O3 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | (9S)-8-N-(4-carbamoyl-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(C(N)=O)ccn1)[C@H]1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C20H20F3N7O3/c1-10(20(21,22)23)26-18(32)13-2-3-14-17(27-13)30(12-5-7-29(14)9-12)19(33)28-15-8-11(16(24)31)4-6-25-15/h2-4,6,8,10,12H,5,7,9H2,1H3,(H2,24,31)(H,26,32)(H,25,28,33)/t10-,12+/m1/s1 |
| InChIKey | VZRGGOPHHCTUKE-PWSUYJOCSA-N |
| XLogP | 1.89 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |