C23H21FN6O2 — CID 121358133
(9S)-5-N-[(3-fluorophenyl)methyl]-8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121358133) has the molecular formula C23H21FN6O2 and a molecular weight of 432.46 g/mol. Its IUPAC name is (9S)-5-N-[(3-fluorophenyl)methyl]-8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-5-N-[(3-fluorophenyl)methyl]-8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121358133 |
| Molecular Formula | C23H21FN6O2 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (9S)-5-N-[(3-fluorophenyl)methyl]-8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | O=C(NCc1cccc(F)c1)c1ccc2c(n1)N(C(=O)Nc1ccccn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C23H21FN6O2/c24-16-5-3-4-15(12-16)13-26-22(31)18-7-8-19-21(27-18)30(17-9-11-29(19)14-17)23(32)28-20-6-1-2-10-25-20/h1-8,10,12,17H,9,11,13-14H2,(H,26,31)(H,25,28,32)/t17-/m0/s1 |
| InChIKey | ARQZMQSNXQQULS-KRWDZBQOSA-N |
| XLogP | 3.18 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |