C19H19F3N6O2 — CID 121358135
(9S)-3-methyl-8-N-pyridin-2-yl-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121358135) has the molecular formula C19H19F3N6O2 and a molecular weight of 420.40 g/mol. Its IUPAC name is (9S)-3-methyl-8-N-pyridin-2-yl-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-3-methyl-8-N-pyridin-2-yl-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121358135 |
| Molecular Formula | C19H19F3N6O2 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (9S)-3-methyl-8-N-pyridin-2-yl-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | Cc1cc(C(=O)NCC(F)(F)F)nc2c1N1CC[C@@H](C1)N2C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C19H19F3N6O2/c1-11-8-13(17(29)24-10-19(20,21)22)25-16-15(11)27-7-5-12(9-27)28(16)18(30)26-14-4-2-3-6-23-14/h2-4,6,8,12H,5,7,9-10H2,1H3,(H,24,29)(H,23,26,30)/t12-/m0/s1 |
| InChIKey | XPGLWGYRGXHSSW-LBPRGKRZSA-N |
| XLogP | 2.71 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |