C21H22F3N7O3 — CID 121358150
(9S)-8-N-(4-acetamido-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121358150) has the molecular formula C21H22F3N7O3 and a molecular weight of 477.45 g/mol. Its IUPAC name is (9S)-8-N-(4-acetamido-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-(4-acetamido-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121358150 |
| Molecular Formula | C21H22F3N7O3 |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | (9S)-8-N-(4-acetamido-2-pyridinyl)-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | CC(=O)Nc1ccnc(NC(=O)N2c3nc(C(=O)N[C@H](C)C(F)(F)F)ccc3N3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C21H22F3N7O3/c1-11(21(22,23)24)26-19(33)15-3-4-16-18(28-15)31(14-6-8-30(16)10-14)20(34)29-17-9-13(5-7-25-17)27-12(2)32/h3-5,7,9,11,14H,6,8,10H2,1-2H3,(H,26,33)(H2,25,27,29,32,34)/t11-,14+/m1/s1 |
| InChIKey | FMHACJZZDHIYKE-RISCZKNCSA-N |
| XLogP | 2.75 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |