C16H24N4 — CID 121358181
5-[2-[(3E,5Z)-octa-1,3,5-trien-3-yl]pyrrolidin-1-yl]-1,2-dihydropyrazin-3-amine (PubChem CID 121358181) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is 5-[2-[(3E,5Z)-octa-1,3,5-trien-3-yl]pyrrolidin-1-yl]-1,2-dihydropyrazin-3-amine.
| Compound Name | 5-[2-[(3E,5Z)-octa-1,3,5-trien-3-yl]pyrrolidin-1-yl]-1,2-dihydropyrazin-3-amine |
|---|---|
| PubChem CID | 121358181 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 5-[2-[(3E,5Z)-octa-1,3,5-trien-3-yl]pyrrolidin-1-yl]-1,2-dihydropyrazin-3-amine |
| SMILES | C=C/C(=C\C=C/CC)C1CCCN1C1=CNCC(N)=N1 |
| InChI | InChI=1S/C16H24N4/c1-3-5-6-8-13(4-2)14-9-7-10-20(14)16-12-18-11-15(17)19-16/h4-6,8,12,14,18H,2-3,7,9-11H2,1H3,(H2,17,19)/b6-5-,13-8+ |
| InChIKey | FYNLUIDJWMLVJT-AVHOOITRSA-N |
| XLogP | 2.29 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|