About 2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine
2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine (PubChem CID 121358404) has the molecular formula C6H11N5O
and a molecular weight of 169.19 g/mol. Its IUPAC name is 2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine.
Molecular Properties
| Compound Name | 2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine |
| PubChem CID | 121358404 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | 2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine |
| SMILES | CC1CC(=O)NC(N=C(N)N)=N1 |
| InChI | InChI=1S/C6H11N5O/c1-3-2-4(12)10-6(9-3)11-5(7)8/h3H,2H2,1H3,(H5,7,8,9,10,11,12) |
| InChIKey | JYCMOBJHEMUXRX-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine?
The IUPAC name of 2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine (CID 121358404) is 2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine.
What is the SMILES notation for 2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine?
The canonical SMILES for 2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine is CC1CC(=O)NC(N=C(N)N)=N1.
What is the InChIKey of 2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine?
The InChIKey is JYCMOBJHEMUXRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N5O/c1-3-2-4(12)10-6(9-3)11-5(7)8/h3H,2H2,1H3,(H5,7,8,9,10,11,12).
What are the key properties of 2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine?
2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine has a molecular weight of 169.19 g/mol, XLogP of -1.48, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl)guanidine is sourced from PubChem (CID 121358404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).