About (4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine
(4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine (PubChem CID 121358712) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is (4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | (4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine |
| PubChem CID | 121358712 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine |
| SMILES | C[C@H]1C=C(C2C=CC=CC2)N=CC1 |
| InChI | InChI=1S/C12H15N/c1-10-7-8-13-12(9-10)11-5-3-2-4-6-11/h2-5,8-11H,6-7H2,1H3/t10-,11?/m1/s1 |
| InChIKey | VMOORJCOUQEQJA-NFJWQWPMSA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine?
The IUPAC name of (4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine (CID 121358712) is (4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine.
What is the SMILES notation for (4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine?
The canonical SMILES for (4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine is C[C@H]1C=C(C2C=CC=CC2)N=CC1.
What is the InChIKey of (4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine?
The InChIKey is VMOORJCOUQEQJA-NFJWQWPMSA-N. The full InChI is InChI=1S/C12H15N/c1-10-7-8-13-12(9-10)11-5-3-2-4-6-11/h2-5,8-11H,6-7H2,1H3/t10-,11?/m1/s1.
What are the key properties of (4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine?
(4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine has a molecular weight of 173.26 g/mol, XLogP of 3.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-6-cyclohexa-2,4-dien-1-yl-4-methyl-3,4-dihydropyridine is sourced from PubChem (CID 121358712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).