C13H28F3N3 — CID 121358939
3-N-[3-(ethylamino)butyl]-3-methyl-1-N-(2,2,2-trifluoroethyl)butane-1,3-diamine (PubChem CID 121358939) has the molecular formula C13H28F3N3 and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-N-[3-(ethylamino)butyl]-3-methyl-1-N-(2,2,2-trifluoroethyl)butane-1,3-diamine.
| Compound Name | 3-N-[3-(ethylamino)butyl]-3-methyl-1-N-(2,2,2-trifluoroethyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 121358939 |
| Molecular Formula | C13H28F3N3 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.22 |
| IUPAC Name | 3-N-[3-(ethylamino)butyl]-3-methyl-1-N-(2,2,2-trifluoroethyl)butane-1,3-diamine |
| SMILES | CCNC(C)CCNC(C)(C)CCNCC(F)(F)F |
| InChI | InChI=1S/C13H28F3N3/c1-5-18-11(2)6-8-19-12(3,4)7-9-17-10-13(14,15)16/h11,17-19H,5-10H2,1-4H3 |
| InChIKey | IOZPSYXQROHEDW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|