C15H22N4O — CID 121359149
(2R,6R)-2,6-dimethyl-4-(1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl)morpholine (PubChem CID 121359149) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-4-(1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl)morpholine.
| Compound Name | (2R,6R)-2,6-dimethyl-4-(1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl)morpholine |
|---|---|
| PubChem CID | 121359149 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-4-(1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl)morpholine |
| SMILES | C[C@@H]1CN(c2ccc3c(n2)NC2CCN3C2)C[C@@H](C)O1 |
| InChI | InChI=1S/C15H22N4O/c1-10-7-19(8-11(2)20-10)14-4-3-13-15(17-14)16-12-5-6-18(13)9-12/h3-4,10-12H,5-9H2,1-2H3,(H,16,17)/t10-,11-,12?/m1/s1 |
| InChIKey | BMHSXKSGDALONB-XFKKCKKNSA-N |
| XLogP | 1.70 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |