C17H18F6O7 — CID 121359151
[1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]propan-2-yl] 4-oxocyclohexane-1-carboxylate (PubChem CID 121359151) has the molecular formula C17H18F6O7 and a molecular weight of 448.31 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]propan-2-yl] 4-oxocyclohexane-1-carboxylate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]propan-2-yl] 4-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 121359151 |
| Molecular Formula | C17H18F6O7 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]propan-2-yl] 4-oxocyclohexane-1-carboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(OC(=O)C1CCC(=O)CC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H18F6O7/c1-9(2)12(25)28-7-8-29-14(27)15(16(18,19)20,17(21,22)23)30-13(26)10-3-5-11(24)6-4-10/h10H,1,3-8H2,2H3 |
| InChIKey | HLMSTKZOXSWHML-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|