C17H20F6O6 — CID 121359226
[1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]propan-2-yl] cyclohexanecarboxylate (PubChem CID 121359226) has the molecular formula C17H20F6O6 and a molecular weight of 434.33 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]propan-2-yl] cyclohexanecarboxylate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]propan-2-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 121359226 |
| Molecular Formula | C17H20F6O6 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]propan-2-yl] cyclohexanecarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(OC(=O)C1CCCCC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H20F6O6/c1-10(2)12(24)27-8-9-28-14(26)15(16(18,19)20,17(21,22)23)29-13(25)11-6-4-3-5-7-11/h11H,1,3-9H2,2H3 |
| InChIKey | RYINXUWEOSXCEK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|