C22H26F6O6 — CID 121359227
2-(2-methylprop-2-enoyloxy)ethyl 2-[2-(1-adamantyl)acetyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propanoate (PubChem CID 121359227) has the molecular formula C22H26F6O6 and a molecular weight of 500.43 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 2-[2-(1-adamantyl)acetyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propanoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-[2-(1-adamantyl)acetyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 121359227 |
| Molecular Formula | C22H26F6O6 |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-[2-(1-adamantyl)acetyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(OC(=O)CC12CC3CC(CC(C3)C1)C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H26F6O6/c1-12(2)17(30)32-3-4-33-18(31)20(21(23,24)25,22(26,27)28)34-16(29)11-19-8-13-5-14(9-19)7-15(6-13)10-19/h13-15H,1,3-11H2,2H3 |
| InChIKey | SQPZUMVMLLZHBU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|