C26H25ClF3N5O3 — CID 121359253
4-chloro-N-[5-[(2R)-2-hydroxybutoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121359253) has the molecular formula C26H25ClF3N5O3 and a molecular weight of 547.97 g/mol. Its IUPAC name is 4-chloro-N-[5-[(2R)-2-hydroxybutoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | 4-chloro-N-[5-[(2R)-2-hydroxybutoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359253 |
| Molecular Formula | C26H25ClF3N5O3 |
| Molecular Weight | 547.97 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | 4-chloro-N-[5-[(2R)-2-hydroxybutoxy]-2-pyridinyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | CC[C@@H](O)COc1ccc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)c(Cl)cc3N3CCC2C3)nc1 |
| InChI | InChI=1S/C26H25ClF3N5O3/c1-2-18(36)14-38-19-6-7-22(31-12-19)32-25(37)35-17-8-9-34(13-17)21-11-20(27)23(33-24(21)35)15-4-3-5-16(10-15)26(28,29)30/h3-7,10-12,17-18,36H,2,8-9,13-14H2,1H3,(H,31,32,37)/t17?,18-/m1/s1 |
| InChIKey | XPMHITIBWYAIDE-QRWMCTBCSA-N |
| XLogP | 5.60 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.97 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |