C25H25F3N6O4 — CID 121359261
N-[2-[(3R)-3,4-dihydroxybutoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121359261) has the molecular formula C25H25F3N6O4 and a molecular weight of 530.51 g/mol. Its IUPAC name is N-[2-[(3R)-3,4-dihydroxybutoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | N-[2-[(3R)-3,4-dihydroxybutoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359261 |
| Molecular Formula | C25H25F3N6O4 |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | N-[2-[(3R)-3,4-dihydroxybutoxy]pyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1ccnc(OCC[C@@H](O)CO)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CCC1C2 |
| InChI | InChI=1S/C25H25F3N6O4/c26-25(27,28)16-3-1-2-15(12-16)19-4-5-20-22(30-19)34(17-7-10-33(20)13-17)24(37)32-21-6-9-29-23(31-21)38-11-8-18(36)14-35/h1-6,9,12,17-18,35-36H,7-8,10-11,13-14H2,(H,29,31,32,37)/t17?,18-/m1/s1 |
| InChIKey | MJKIRCJBQFSBHB-QRWMCTBCSA-N |
| XLogP | 3.31 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |