C15H12ClF3N4 — CID 121359381
4-chloro-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 121359381) has the molecular formula C15H12ClF3N4 and a molecular weight of 340.74 g/mol. Its IUPAC name is 4-chloro-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | 4-chloro-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 121359381 |
| Molecular Formula | C15H12ClF3N4 |
| Molecular Weight | 340.74 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 4-chloro-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | FC(F)(F)c1cc(-c2nc3c(cc2Cl)N2CCC(C2)N3)ccn1 |
| InChI | InChI=1S/C15H12ClF3N4/c16-10-6-11-14(21-9-2-4-23(11)7-9)22-13(10)8-1-3-20-12(5-8)15(17,18)19/h1,3,5-6,9H,2,4,7H2,(H,21,22) |
| InChIKey | NBDVLZNQMRANIW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.74 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |