C20H20F3N9O2 — CID 121359418
(9S)-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(2,2,2-trifluoroethyl)-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide (PubChem CID 121359418) has the molecular formula C20H20F3N9O2 and a molecular weight of 475.44 g/mol. Its IUPAC name is (9S)-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(2,2,2-trifluoroethyl)-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(2,2,2-trifluoroethyl)-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121359418 |
| Molecular Formula | C20H20F3N9O2 |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | (9S)-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(2,2,2-trifluoroethyl)-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide |
| SMILES | Cc1ccc2c(NC(=O)N3c4nc(C(=O)NCC(F)(F)F)ncc4N4CCC[C@H]3C4)n[nH]c2n1 |
| InChI | InChI=1S/C20H20F3N9O2/c1-10-4-5-12-14(26-10)29-30-15(12)28-19(34)32-11-3-2-6-31(8-11)13-7-24-16(27-17(13)32)18(33)25-9-20(21,22)23/h4-5,7,11H,2-3,6,8-9H2,1H3,(H,25,33)(H2,26,28,29,30,34)/t11-/m0/s1 |
| InChIKey | FVWYPCMBXPXPBU-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |