C25H22ClF3N6O3 — CID 121359507
4-chloro-N-[2-[(3S)-oxolan-3-yl]oxypyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121359507) has the molecular formula C25H22ClF3N6O3 and a molecular weight of 546.94 g/mol. Its IUPAC name is 4-chloro-N-[2-[(3S)-oxolan-3-yl]oxypyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | 4-chloro-N-[2-[(3S)-oxolan-3-yl]oxypyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359507 |
| Molecular Formula | C25H22ClF3N6O3 |
| Molecular Weight | 546.94 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | 4-chloro-N-[2-[(3S)-oxolan-3-yl]oxypyrimidin-4-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | O=C(Nc1ccnc(O[C@H]2CCOC2)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)c(Cl)cc2N2CCC1C2 |
| InChI | InChI=1S/C25H22ClF3N6O3/c26-18-11-19-22(33-21(18)14-2-1-3-15(10-14)25(27,28)29)35(16-5-8-34(19)12-16)24(36)32-20-4-7-30-23(31-20)38-17-6-9-37-13-17/h1-4,7,10-11,16-17H,5-6,8-9,12-13H2,(H,30,31,32,36)/t16?,17-/m0/s1 |
| InChIKey | FFGSDMIKSUIPCR-DJNXLDHESA-N |
| XLogP | 5.01 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.94 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |