C25H24N8O — CID 121359522
(9S)-N-[5-(5-methyl-1H-pyrazol-4-yl)-3-pyridinyl]-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121359522) has the molecular formula C25H24N8O and a molecular weight of 452.52 g/mol. Its IUPAC name is (9S)-N-[5-(5-methyl-1H-pyrazol-4-yl)-3-pyridinyl]-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[5-(5-methyl-1H-pyrazol-4-yl)-3-pyridinyl]-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359522 |
| Molecular Formula | C25H24N8O |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | (9S)-N-[5-(5-methyl-1H-pyrazol-4-yl)-3-pyridinyl]-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1cc(-c2ccc3c(n2)N(C(=O)Nc2cncc(-c4cn[nH]c4C)c2)[C@H]2CCN3C2)ccn1 |
| InChI | InChI=1S/C25H24N8O/c1-15-9-17(5-7-27-15)22-3-4-23-24(30-22)33(20-6-8-32(23)14-20)25(34)29-19-10-18(11-26-12-19)21-13-28-31-16(21)2/h3-5,7,9-13,20H,6,8,14H2,1-2H3,(H,28,31)(H,29,34)/t20-/m0/s1 |
| InChIKey | VUSGOAWDRVDPHG-FQEVSTJZSA-N |
| XLogP | 4.18 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |