C28H31F3N6O4S — CID 121359542
N-[6-[4-(2-sulfanyloxypropan-2-yloxy)butoxy]pyrazin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121359542) has the molecular formula C28H31F3N6O4S and a molecular weight of 604.66 g/mol. Its IUPAC name is N-[6-[4-(2-sulfanyloxypropan-2-yloxy)butoxy]pyrazin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | N-[6-[4-(2-sulfanyloxypropan-2-yloxy)butoxy]pyrazin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359542 |
| Molecular Formula | C28H31F3N6O4S |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | N-[6-[4-(2-sulfanyloxypropan-2-yloxy)butoxy]pyrazin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CC(C)(OS)OCCCCOc1cncc(NC(=O)N2c3nc(-c4cccc(C(F)(F)F)c4)ccc3N3CCC2C3)n1 |
| InChI | InChI=1S/C28H31F3N6O4S/c1-27(2,41-42)40-13-4-3-12-39-24-16-32-15-23(34-24)35-26(38)37-20-10-11-36(17-20)22-9-8-21(33-25(22)37)18-6-5-7-19(14-18)28(29,30)31/h5-9,14-16,20,42H,3-4,10-13,17H2,1-2H3,(H,34,35,38) |
| InChIKey | DRYAAWVNHQNCFZ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|