C26H25F3N6O4 — CID 121359565
(9S)-N-[6-[(2R)-2,3-dihydroxypropoxy]pyrimidin-4-yl]-4-ethenyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121359565) has the molecular formula C26H25F3N6O4 and a molecular weight of 542.52 g/mol. Its IUPAC name is (9S)-N-[6-[(2R)-2,3-dihydroxypropoxy]pyrimidin-4-yl]-4-ethenyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[6-[(2R)-2,3-dihydroxypropoxy]pyrimidin-4-yl]-4-ethenyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359565 |
| Molecular Formula | C26H25F3N6O4 |
| Molecular Weight | 542.52 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | (9S)-N-[6-[(2R)-2,3-dihydroxypropoxy]pyrimidin-4-yl]-4-ethenyl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | C=Cc1cc2c(nc1-c1cccc(C(F)(F)F)c1)N(C(=O)Nc1cc(OC[C@H](O)CO)ncn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C26H25F3N6O4/c1-2-15-9-20-24(33-23(15)16-4-3-5-17(8-16)26(27,28)29)35(18-6-7-34(20)11-18)25(38)32-21-10-22(31-14-30-21)39-13-19(37)12-36/h2-5,8-10,14,18-19,36-37H,1,6-7,11-13H2,(H,30,31,32,38)/t18-,19+/m0/s1 |
| InChIKey | WZCUNCJWNXFWNC-RBUKOAKNSA-N |
| XLogP | 3.56 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |