C27H20ClF3N6O — CID 121359566
(9S)-4-chloro-N-(4-phenylpyrimidin-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 121359566) has the molecular formula C27H20ClF3N6O and a molecular weight of 536.95 g/mol. Its IUPAC name is (9S)-4-chloro-N-(4-phenylpyrimidin-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-4-chloro-N-(4-phenylpyrimidin-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359566 |
| Molecular Formula | C27H20ClF3N6O |
| Molecular Weight | 536.95 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | (9S)-4-chloro-N-(4-phenylpyrimidin-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | O=C(Nc1nccc(-c2ccccc2)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)c(Cl)cc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C27H20ClF3N6O/c28-20-14-22-24(34-23(20)17-7-4-8-18(13-17)27(29,30)31)37(19-10-12-36(22)15-19)26(38)35-25-32-11-9-21(33-25)16-5-2-1-3-6-16/h1-9,11,13-14,19H,10,12,15H2,(H,32,33,35,38)/t19-/m0/s1 |
| InChIKey | TYFMOCMIYMXZIG-IBGZPJMESA-N |
| XLogP | 6.51 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.95 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |