C23H21F3N6O3 — CID 121359592
(9S)-N-[6-(2-hydroxyethoxy)pyrazin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121359592) has the molecular formula C23H21F3N6O3 and a molecular weight of 486.45 g/mol. Its IUPAC name is (9S)-N-[6-(2-hydroxyethoxy)pyrazin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[6-(2-hydroxyethoxy)pyrazin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359592 |
| Molecular Formula | C23H21F3N6O3 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | (9S)-N-[6-(2-hydroxyethoxy)pyrazin-2-yl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1cncc(OCCO)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C23H21F3N6O3/c24-23(25,26)15-3-1-2-14(10-15)17-4-5-18-21(28-17)32(16-6-7-31(18)13-16)22(34)30-19-11-27-12-20(29-19)35-9-8-33/h1-5,10-12,16,33H,6-9,13H2,(H,29,30,34)/t16-/m0/s1 |
| InChIKey | ZTTQWCOYBGQBCP-INIZCTEOSA-N |
| XLogP | 3.56 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |