C20H17F2N7O2 — CID 121359648
5-[6-(difluoromethoxy)-3-pyridinyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121359648) has the molecular formula C20H17F2N7O2 and a molecular weight of 425.40 g/mol. Its IUPAC name is 5-[6-(difluoromethoxy)-3-pyridinyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | 5-[6-(difluoromethoxy)-3-pyridinyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359648 |
| Molecular Formula | C20H17F2N7O2 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 5-[6-(difluoromethoxy)-3-pyridinyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1cnccn1)N1c2nc(-c3ccc(OC(F)F)nc3)ccc2N2CCC1C2 |
| InChI | InChI=1S/C20H17F2N7O2/c21-19(22)31-17-4-1-12(9-25-17)14-2-3-15-18(26-14)29(13-5-8-28(15)11-13)20(30)27-16-10-23-6-7-24-16/h1-4,6-7,9-10,13,19H,5,8,11H2,(H,24,27,30) |
| InChIKey | OPWOTHIYOWVMFM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |