C19H15F3N8O — CID 121359722
N-pyrazin-2-yl-5-[2-(trifluoromethyl)pyrimidin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121359722) has the molecular formula C19H15F3N8O and a molecular weight of 428.38 g/mol. Its IUPAC name is N-pyrazin-2-yl-5-[2-(trifluoromethyl)pyrimidin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | N-pyrazin-2-yl-5-[2-(trifluoromethyl)pyrimidin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359722 |
| Molecular Formula | C19H15F3N8O |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-pyrazin-2-yl-5-[2-(trifluoromethyl)pyrimidin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1cnccn1)N1c2nc(-c3ccnc(C(F)(F)F)n3)ccc2N2CCC1C2 |
| InChI | InChI=1S/C19H15F3N8O/c20-19(21,22)17-25-5-3-13(27-17)12-1-2-14-16(26-12)30(11-4-8-29(14)10-11)18(31)28-15-9-23-6-7-24-15/h1-3,5-7,9,11H,4,8,10H2,(H,24,28,31) |
| InChIKey | OCVXVOGISMGSKV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |