C24H17F4N5OS — CID 121359728
(9S)-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121359728) has the molecular formula C24H17F4N5OS and a molecular weight of 499.49 g/mol. Its IUPAC name is (9S)-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359728 |
| Molecular Formula | C24H17F4N5OS |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | (9S)-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1nc2ccc(F)cc2s1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C24H17F4N5OS/c25-15-4-5-18-20(11-15)35-22(30-18)31-23(34)33-16-8-9-32(12-16)19-7-6-17(29-21(19)33)13-2-1-3-14(10-13)24(26,27)28/h1-7,10-11,16H,8-9,12H2,(H,30,31,34)/t16-/m0/s1 |
| InChIKey | ABQRWIFWSTVELD-INIZCTEOSA-N |
| XLogP | 6.15 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |