C15H16INO2S — CID 121359893
2-[[2-(4-ethylphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfanyl]acetyl iodide (PubChem CID 121359893) has the molecular formula C15H16INO2S and a molecular weight of 401.27 g/mol. Its IUPAC name is 2-[[2-(4-ethylphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfanyl]acetyl iodide.
| Compound Name | 2-[[2-(4-ethylphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfanyl]acetyl iodide |
|---|---|
| PubChem CID | 121359893 |
| Molecular Formula | C15H16INO2S |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | 2-[[2-(4-ethylphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfanyl]acetyl iodide |
| SMILES | CCc1ccc(-c2nc(CSCC(=O)I)c(C)o2)cc1 |
| InChI | InChI=1S/C15H16INO2S/c1-3-11-4-6-12(7-5-11)15-17-13(10(2)19-15)8-20-9-14(16)18/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | VVLPTOFBSGIPOH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|