C10H13N3 — CID 121360259
2,4-dimethyl-6-[(3E)-penta-1,3-dien-3-yl]-1,3,5-triazine (PubChem CID 121360259) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2,4-dimethyl-6-[(3E)-penta-1,3-dien-3-yl]-1,3,5-triazine.
| Compound Name | 2,4-dimethyl-6-[(3E)-penta-1,3-dien-3-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 121360259 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2,4-dimethyl-6-[(3E)-penta-1,3-dien-3-yl]-1,3,5-triazine |
| SMILES | C=C/C(=C\C)c1nc(C)nc(C)n1 |
| InChI | InChI=1S/C10H13N3/c1-5-9(6-2)10-12-7(3)11-8(4)13-10/h5-6H,1H2,2-4H3/b9-6+ |
| InChIKey | WBMQCPNPEXVLFJ-RMKNXTFCSA-N |
| XLogP | 2.08 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|