About N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide
N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide (PubChem CID 121360866) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide |
| PubChem CID | 121360866 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide |
| SMILES | CNC1=C=C(NC(C)=O)C1 |
| InChI | InChI=1S/C7H10N2O/c1-5(10)9-7-3-6(4-7)8-2/h8H,3H2,1-2H3,(H,9,10) |
| InChIKey | BOCAVQBARCXUKK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide?
The IUPAC name of N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide (CID 121360866) is N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide.
What is the SMILES notation for N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide?
The canonical SMILES for N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide is CNC1=C=C(NC(C)=O)C1.
What is the InChIKey of N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide?
The InChIKey is BOCAVQBARCXUKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-5(10)9-7-3-6(4-7)8-2/h8H,3H2,1-2H3,(H,9,10).
What are the key properties of N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide?
N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide has a molecular weight of 138.17 g/mol, XLogP of 0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(methylamino)cyclobuta-1,2-dien-1-yl]acetamide is sourced from PubChem (CID 121360866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).