About furo[3,4-d]pyridazine
furo[3,4-d]pyridazine (PubChem CID 121361673) has the molecular formula C6H4N2O
and a molecular weight of 120.11 g/mol. Its IUPAC name is furo[3,4-d]pyridazine.
Molecular Properties
| Compound Name | furo[3,4-d]pyridazine |
| PubChem CID | 121361673 |
| Molecular Formula | C6H4N2O |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.03 |
| IUPAC Name | furo[3,4-d]pyridazine |
| SMILES | c1nncc2cocc12 |
| InChI | InChI=1S/C6H4N2O/c1-5-3-9-4-6(5)2-8-7-1/h1-4H |
| InChIKey | ZDJSKWAPIVMIAL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furo[3,4-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,4-d]pyridazine?
The IUPAC name of furo[3,4-d]pyridazine (CID 121361673) is furo[3,4-d]pyridazine.
What is the SMILES notation for furo[3,4-d]pyridazine?
The canonical SMILES for furo[3,4-d]pyridazine is c1nncc2cocc12.
What is the InChIKey of furo[3,4-d]pyridazine?
The InChIKey is ZDJSKWAPIVMIAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O/c1-5-3-9-4-6(5)2-8-7-1/h1-4H.
What are the key properties of furo[3,4-d]pyridazine?
furo[3,4-d]pyridazine has a molecular weight of 120.11 g/mol, XLogP of 1.22, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,4-d]pyridazine is sourced from PubChem (CID 121361673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).