C20H19F6NO3 — CID 121361830
4-[1-[[(3aR,6aR)-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl]oxy]-2,2,2-trifluoroethyl]-3,3,5-trifluoro-1H-indol-2-one (PubChem CID 121361830) has the molecular formula C20H19F6NO3 and a molecular weight of 435.36 g/mol. Its IUPAC name is 4-[1-[[(3aR,6aR)-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl]oxy]-2,2,2-trifluoroethyl]-3,3,5-trifluoro-1H-indol-2-one.
| Compound Name | 4-[1-[[(3aR,6aR)-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl]oxy]-2,2,2-trifluoroethyl]-3,3,5-trifluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 121361830 |
| Molecular Formula | C20H19F6NO3 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 4-[1-[[(3aR,6aR)-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl]oxy]-2,2,2-trifluoroethyl]-3,3,5-trifluoro-1H-indol-2-one |
| SMILES | C=CC[C@@]12CCC[C@]1(OC(c1c(F)ccc3c1C(F)(F)C(=O)N3)C(F)(F)F)OCC2 |
| InChI | InChI=1S/C20H19F6NO3/c1-2-6-17-7-3-8-18(17,29-10-9-17)30-15(20(24,25)26)13-11(21)4-5-12-14(13)19(22,23)16(28)27-12/h2,4-5,15H,1,3,6-10H2,(H,27,28)/t15?,17-,18+/m0/s1 |
| InChIKey | GRWHKZIFXKXLGJ-XSRYCBBQSA-N |
| XLogP | 5.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|