C20H20F5NO3 — CID 121361832
4-[(1R)-1-[[(3aR,6aR)-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl]oxy]-2,2,2-trifluoroethyl]-3,3-difluoro-1H-indol-2-one (PubChem CID 121361832) has the molecular formula C20H20F5NO3 and a molecular weight of 417.37 g/mol. Its IUPAC name is 4-[(1R)-1-[[(3aR,6aR)-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl]oxy]-2,2,2-trifluoroethyl]-3,3-difluoro-1H-indol-2-one.
| Compound Name | 4-[(1R)-1-[[(3aR,6aR)-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl]oxy]-2,2,2-trifluoroethyl]-3,3-difluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 121361832 |
| Molecular Formula | C20H20F5NO3 |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 4-[(1R)-1-[[(3aR,6aR)-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl]oxy]-2,2,2-trifluoroethyl]-3,3-difluoro-1H-indol-2-one |
| SMILES | C=CC[C@@]12CCC[C@]1(O[C@H](c1cccc3c1C(F)(F)C(=O)N3)C(F)(F)F)OCC2 |
| InChI | InChI=1S/C20H20F5NO3/c1-2-7-17-8-4-9-18(17,28-11-10-17)29-15(20(23,24)25)12-5-3-6-13-14(12)19(21,22)16(27)26-13/h2-3,5-6,15H,1,4,7-11H2,(H,26,27)/t15-,17+,18-/m1/s1 |
| InChIKey | HEUXGQGFCFCINU-BPQIPLTHSA-N |
| XLogP | 5.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|