C20H21F4NO3 — CID 121361951
4-[1-[[(3aR,6aR)-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl]oxy]-2,2-difluoroethyl]-3,3-difluoro-1H-indol-2-one (PubChem CID 121361951) has the molecular formula C20H21F4NO3 and a molecular weight of 399.38 g/mol. Its IUPAC name is 4-[1-[[(3aR,6aR)-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl]oxy]-2,2-difluoroethyl]-3,3-difluoro-1H-indol-2-one.
| Compound Name | 4-[1-[[(3aR,6aR)-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl]oxy]-2,2-difluoroethyl]-3,3-difluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 121361951 |
| Molecular Formula | C20H21F4NO3 |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-[1-[[(3aR,6aR)-3a-prop-2-enyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-6a-yl]oxy]-2,2-difluoroethyl]-3,3-difluoro-1H-indol-2-one |
| SMILES | C=CC[C@@]12CCC[C@]1(OC(c1cccc3c1C(F)(F)C(=O)N3)C(F)F)OCC2 |
| InChI | InChI=1S/C20H21F4NO3/c1-2-7-18-8-4-9-19(18,27-11-10-18)28-15(16(21)22)12-5-3-6-13-14(12)20(23,24)17(26)25-13/h2-3,5-6,15-16H,1,4,7-11H2,(H,25,26)/t15?,18-,19+/m0/s1 |
| InChIKey | FWCNJSQKTSBCQD-AOWWOYQVSA-N |
| XLogP | 4.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|