About [(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate
[(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate (PubChem CID 121362100) has the molecular formula C25H19F2N5O3
and a molecular weight of 475.46 g/mol. Its IUPAC name is [(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate.
Molecular Properties
| Compound Name | [(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate |
| PubChem CID | 121362100 |
| Molecular Formula | C25H19F2N5O3 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | [(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1)c1cccc2c1C(F)(F)C(=O)N2Cc1cncc(-n2ccnn2)c1 |
| InChI | InChI=1S/C25H19F2N5O3/c1-16(35-23(33)18-6-3-2-4-7-18)20-8-5-9-21-22(20)25(26,27)24(34)31(21)15-17-12-19(14-28-13-17)32-11-10-29-30-32/h2-14,16H,15H2,1H3/t16-/m0/s1 |
| InChIKey | KABDSJNUBHLOGF-INIZCTEOSA-N |
| XLogP | 4.22 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate?
The IUPAC name of [(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate (CID 121362100) is [(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate.
What is the SMILES notation for [(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate?
The canonical SMILES for [(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate is C[C@H](OC(=O)c1ccccc1)c1cccc2c1C(F)(F)C(=O)N2Cc1cncc(-n2ccnn2)c1.
What is the InChIKey of [(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate?
The InChIKey is KABDSJNUBHLOGF-INIZCTEOSA-N. The full InChI is InChI=1S/C25H19F2N5O3/c1-16(35-23(33)18-6-3-2-4-7-18)20-8-5-9-21-22(20)25(26,27)24(34)31(21)15-17-12-19(14-28-13-17)32-11-10-29-30-32/h2-14,16H,15H2,1H3/t16-/m0/s1.
What are the key properties of [(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate?
[(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate has a molecular weight of 475.46 g/mol, XLogP of 4.22, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-[3,3-difluoro-2-oxo-1-[[5-(triazol-1-yl)-3-pyridinyl]methyl]indol-4-yl]ethyl] benzoate is sourced from PubChem (CID 121362100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).