C15H22O — CID 121362306
6,8a-bis(prop-2-enyl)-2,3,4,4a,5,6-hexahydrochromene (PubChem CID 121362306) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 6,8a-bis(prop-2-enyl)-2,3,4,4a,5,6-hexahydrochromene.
| Compound Name | 6,8a-bis(prop-2-enyl)-2,3,4,4a,5,6-hexahydrochromene |
|---|---|
| PubChem CID | 121362306 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 6,8a-bis(prop-2-enyl)-2,3,4,4a,5,6-hexahydrochromene |
| SMILES | C=CCC1C=CC2(CC=C)OCCCC2C1 |
| InChI | InChI=1S/C15H22O/c1-3-6-13-8-10-15(9-4-2)14(12-13)7-5-11-16-15/h3-4,8,10,13-14H,1-2,5-7,9,11-12H2 |
| InChIKey | HHSCZMXARQHEQS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|