About CID 121362412
CID 121362412 (PubChem CID 121362412) has the molecular formula C6H2F5NO2S
and a molecular weight of 247.14 g/mol.
Molecular Properties
| Compound Name | CID 121362412 |
| PubChem CID | 121362412 |
| Molecular Formula | C6H2F5NO2S |
| Molecular Weight | 247.14 g/mol |
| Exact Mass | 246.97 |
| IUPAC Name | — |
| SMILES | Fc1cc(F)c(F)c(F)c1F.N=S(=O)=O |
| InChI | InChI=1S/C6HF5.HNO2S/c7-2-1-3(8)5(10)6(11)4(2)9;1-4(2)3/h1H;1H |
| InChIKey | SQRWJTCCANOFDK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.14 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze CID 121362412 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 121362412?
The IUPAC name of CID 121362412 (CID 121362412) is not available.
What is the SMILES notation for CID 121362412?
The canonical SMILES for CID 121362412 is Fc1cc(F)c(F)c(F)c1F.N=S(=O)=O.
What is the InChIKey of CID 121362412?
The InChIKey is SQRWJTCCANOFDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HF5.HNO2S/c7-2-1-3(8)5(10)6(11)4(2)9;1-4(2)3/h1H;1H.
What are the key properties of CID 121362412?
CID 121362412 has a molecular weight of 247.14 g/mol, XLogP of 2.01, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 121362412 is sourced from PubChem (CID 121362412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).