C18H10ClF6N5O — CID 121362504
(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2-chloro-3-pyridinyl)prop-2-enamide (PubChem CID 121362504) has the molecular formula C18H10ClF6N5O and a molecular weight of 461.75 g/mol. Its IUPAC name is (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2-chloro-3-pyridinyl)prop-2-enamide.
| Compound Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2-chloro-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 121362504 |
| Molecular Formula | C18H10ClF6N5O |
| Molecular Weight | 461.75 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | (Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(2-chloro-3-pyridinyl)prop-2-enamide |
| SMILES | NC(=O)/C(=C\n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cccnc1Cl |
| InChI | InChI=1S/C18H10ClF6N5O/c19-14-12(2-1-3-27-14)13(15(26)31)7-30-8-28-16(29-30)9-4-10(17(20,21)22)6-11(5-9)18(23,24)25/h1-8H,(H2,26,31)/b13-7- |
| InChIKey | DJRPOKKBOLYUCN-QPEQYQDCSA-N |
| XLogP | 4.51 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.75 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|