About methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate
methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate (PubChem CID 121362662) has the molecular formula C22H26N2O5
and a molecular weight of 398.46 g/mol. Its IUPAC name is methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate |
| PubChem CID | 121362662 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate |
| SMILES | CCO[C@H]1CCN(C(=O)OCc2ccccc2)[C@H](c2ccc(C(=O)OC)nc2)C1 |
| InChI | InChI=1S/C22H26N2O5/c1-3-28-18-11-12-24(22(26)29-15-16-7-5-4-6-8-16)20(13-18)17-9-10-19(23-14-17)21(25)27-2/h4-10,14,18,20H,3,11-13,15H2,1-2H3/t18-,20-/m0/s1 |
| InChIKey | HICARYXMBZPMRU-ICSRJNTNSA-N |
| XLogP | 3.75 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate?
The IUPAC name of methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate (CID 121362662) is methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate?
The canonical SMILES for methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate is CCO[C@H]1CCN(C(=O)OCc2ccccc2)[C@H](c2ccc(C(=O)OC)nc2)C1.
What is the InChIKey of methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate?
The InChIKey is HICARYXMBZPMRU-ICSRJNTNSA-N. The full InChI is InChI=1S/C22H26N2O5/c1-3-28-18-11-12-24(22(26)29-15-16-7-5-4-6-8-16)20(13-18)17-9-10-19(23-14-17)21(25)27-2/h4-10,14,18,20H,3,11-13,15H2,1-2H3/t18-,20-/m0/s1.
What are the key properties of methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate?
methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate has a molecular weight of 398.46 g/mol, XLogP of 3.75, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(2S,4S)-4-ethoxy-1-phenylmethoxycarbonylpiperidin-2-yl]pyridine-2-carboxylate is sourced from PubChem (CID 121362662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).