C23H15F4N5S — CID 121363122
N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-6-methyl-1H-benzimidazol-5-yl]-4-pyridin-4-yl-1,3-thiazol-2-amine (PubChem CID 121363122) has the molecular formula C23H15F4N5S and a molecular weight of 469.47 g/mol. Its IUPAC name is N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-6-methyl-1H-benzimidazol-5-yl]-4-pyridin-4-yl-1,3-thiazol-2-amine.
| Compound Name | N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-6-methyl-1H-benzimidazol-5-yl]-4-pyridin-4-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 121363122 |
| Molecular Formula | C23H15F4N5S |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-6-methyl-1H-benzimidazol-5-yl]-4-pyridin-4-yl-1,3-thiazol-2-amine |
| SMILES | Cc1cc2[nH]c(-c3cc(F)cc(C(F)(F)F)c3)nc2cc1Nc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C23H15F4N5S/c1-12-6-18-19(30-21(29-18)14-7-15(23(25,26)27)9-16(24)8-14)10-17(12)31-22-32-20(11-33-22)13-2-4-28-5-3-13/h2-11H,1H3,(H,29,30)(H,31,32) |
| InChIKey | DXADCJXRWSSKGJ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazole_amine_M(1)', 'substructure': 'N/A'} |
|---|