C24H17F4N5S — CID 121363164
N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-1,6-dimethylbenzimidazol-5-yl]-4-pyridin-4-yl-1,3-thiazol-2-amine (PubChem CID 121363164) has the molecular formula C24H17F4N5S and a molecular weight of 483.49 g/mol. Its IUPAC name is N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-1,6-dimethylbenzimidazol-5-yl]-4-pyridin-4-yl-1,3-thiazol-2-amine.
| Compound Name | N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-1,6-dimethylbenzimidazol-5-yl]-4-pyridin-4-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 121363164 |
| Molecular Formula | C24H17F4N5S |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | N-[2-[3-fluoro-5-(trifluoromethyl)phenyl]-1,6-dimethylbenzimidazol-5-yl]-4-pyridin-4-yl-1,3-thiazol-2-amine |
| SMILES | Cc1cc2c(cc1Nc1nc(-c3ccncc3)cs1)nc(-c1cc(F)cc(C(F)(F)F)c1)n2C |
| InChI | InChI=1S/C24H17F4N5S/c1-13-7-21-19(11-18(13)31-23-32-20(12-34-23)14-3-5-29-6-4-14)30-22(33(21)2)15-8-16(24(26,27)28)10-17(25)9-15/h3-12H,1-2H3,(H,31,32) |
| InChIKey | QRDAYXVAEWHKGH-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazole_amine_M(1)', 'substructure': 'N/A'} |
|---|