About 3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid
3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid (PubChem CID 121363526) has the molecular formula C20H15N3O4
and a molecular weight of 361.36 g/mol. Its IUPAC name is 3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid |
| PubChem CID | 121363526 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNC(=O)c2ccc3c(c2)COc2cncnc2-3)c1 |
| InChI | InChI=1S/C20H15N3O4/c24-19(22-8-12-2-1-3-14(6-12)20(25)26)13-4-5-16-15(7-13)10-27-17-9-21-11-23-18(16)17/h1-7,9,11H,8,10H2,(H,22,24)(H,25,26) |
| InChIKey | ZVPNZTRADRKWRD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid?
The IUPAC name of 3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid (CID 121363526) is 3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid.
What is the SMILES notation for 3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid?
The canonical SMILES for 3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid is O=C(O)c1cccc(CNC(=O)c2ccc3c(c2)COc2cncnc2-3)c1.
What is the InChIKey of 3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid?
The InChIKey is ZVPNZTRADRKWRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O4/c24-19(22-8-12-2-1-3-14(6-12)20(25)26)13-4-5-16-15(7-13)10-27-17-9-21-11-23-18(16)17/h1-7,9,11H,8,10H2,(H,22,24)(H,25,26).
What are the key properties of 3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid?
3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid has a molecular weight of 361.36 g/mol, XLogP of 2.66, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6H-isochromeno[4,3-d]pyrimidine-8-carbonylamino)methyl]benzoic acid is sourced from PubChem (CID 121363526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).