C21H17ClN2O2 — CID 121363689
N-[(1R)-1-(2-chlorophenyl)ethyl]-6H-isochromeno[3,4-c]pyridine-8-carboxamide (PubChem CID 121363689) has the molecular formula C21H17ClN2O2 and a molecular weight of 364.83 g/mol. Its IUPAC name is N-[(1R)-1-(2-chlorophenyl)ethyl]-6H-isochromeno[3,4-c]pyridine-8-carboxamide.
| Compound Name | N-[(1R)-1-(2-chlorophenyl)ethyl]-6H-isochromeno[3,4-c]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 121363689 |
| Molecular Formula | C21H17ClN2O2 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-[(1R)-1-(2-chlorophenyl)ethyl]-6H-isochromeno[3,4-c]pyridine-8-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(c1)COc1cnccc1-2)c1ccccc1Cl |
| InChI | InChI=1S/C21H17ClN2O2/c1-13(16-4-2-3-5-19(16)22)24-21(25)14-6-7-17-15(10-14)12-26-20-11-23-9-8-18(17)20/h2-11,13H,12H2,1H3,(H,24,25)/t13-/m1/s1 |
| InChIKey | USLFLIWOEFKGJX-CYBMUJFWSA-N |
| XLogP | 4.79 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |