About 9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide
9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide (PubChem CID 121363748) has the molecular formula C23H23N3O2
and a molecular weight of 373.46 g/mol. Its IUPAC name is 9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide.
Molecular Properties
| Compound Name | 9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide |
| PubChem CID | 121363748 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide |
| SMILES | CCn1c2cnccc2c2ccc(C(=O)N[C@H](C)c3cccc(OC)c3)cc21 |
| InChI | InChI=1S/C23H23N3O2/c1-4-26-21-13-17(8-9-19(21)20-10-11-24-14-22(20)26)23(27)25-15(2)16-6-5-7-18(12-16)28-3/h5-15H,4H2,1-3H3,(H,25,27)/t15-/m1/s1 |
| InChIKey | KHDTWGHINMBUJH-OAHLLOKOSA-N |
| XLogP | 4.71 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide?
The IUPAC name of 9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide (CID 121363748) is 9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide.
What is the SMILES notation for 9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide?
The canonical SMILES for 9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide is CCn1c2cnccc2c2ccc(C(=O)N[C@H](C)c3cccc(OC)c3)cc21.
What is the InChIKey of 9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide?
The InChIKey is KHDTWGHINMBUJH-OAHLLOKOSA-N. The full InChI is InChI=1S/C23H23N3O2/c1-4-26-21-13-17(8-9-19(21)20-10-11-24-14-22(20)26)23(27)25-15(2)16-6-5-7-18(12-16)28-3/h5-15H,4H2,1-3H3,(H,25,27)/t15-/m1/s1.
What are the key properties of 9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide?
9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide has a molecular weight of 373.46 g/mol, XLogP of 4.71, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-N-[(1R)-1-(3-methoxyphenyl)ethyl]pyrido[3,4-b]indole-7-carboxamide is sourced from PubChem (CID 121363748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).