About N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide
N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide (PubChem CID 121363770) has the molecular formula C23H21FN2O2
and a molecular weight of 376.43 g/mol. Its IUPAC name is N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide.
Molecular Properties
| Compound Name | N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide |
| PubChem CID | 121363770 |
| Molecular Formula | C23H21FN2O2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(c1)C(C)(C)Oc1cnccc1-2)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H21FN2O2/c1-14(15-4-7-17(24)8-5-15)26-22(27)16-6-9-18-19-10-11-25-13-21(19)28-23(2,3)20(18)12-16/h4-14H,1-3H3,(H,26,27)/t14-/m1/s1 |
| InChIKey | YATCIPCKBIWGJD-CQSZACIVSA-N |
| XLogP | 5.01 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide?
The IUPAC name of N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide (CID 121363770) is N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide.
What is the SMILES notation for N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide?
The canonical SMILES for N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide is C[C@@H](NC(=O)c1ccc2c(c1)C(C)(C)Oc1cnccc1-2)c1ccc(F)cc1.
What is the InChIKey of N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide?
The InChIKey is YATCIPCKBIWGJD-CQSZACIVSA-N. The full InChI is InChI=1S/C23H21FN2O2/c1-14(15-4-7-17(24)8-5-15)26-22(27)16-6-9-18-19-10-11-25-13-21(19)28-23(2,3)20(18)12-16/h4-14H,1-3H3,(H,26,27)/t14-/m1/s1.
What are the key properties of N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide?
N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide has a molecular weight of 376.43 g/mol, XLogP of 5.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-(4-fluorophenyl)ethyl]-6,6-dimethylisochromeno[3,4-c]pyridine-8-carboxamide is sourced from PubChem (CID 121363770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).