About N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide
N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide (PubChem CID 121363928) has the molecular formula C20H16N2O4S
and a molecular weight of 380.43 g/mol. Its IUPAC name is N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide.
Molecular Properties
| Compound Name | N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide |
| PubChem CID | 121363928 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2ccc3c(c2)OCc2cnccc2-3)cc1 |
| InChI | InChI=1S/C20H16N2O4S/c1-27(24,25)16-5-2-13(3-6-16)20(23)22-15-4-7-18-17-8-9-21-11-14(17)12-26-19(18)10-15/h2-11H,12H2,1H3,(H,22,23) |
| InChIKey | ICLOLGJTOXTHQA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide?
The IUPAC name of N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide (CID 121363928) is N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide.
What is the SMILES notation for N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide?
The canonical SMILES for N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide is CS(=O)(=O)c1ccc(C(=O)Nc2ccc3c(c2)OCc2cnccc2-3)cc1.
What is the InChIKey of N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide?
The InChIKey is ICLOLGJTOXTHQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O4S/c1-27(24,25)16-5-2-13(3-6-16)20(23)22-15-4-7-18-17-8-9-21-11-14(17)12-26-19(18)10-15/h2-11H,12H2,1H3,(H,22,23).
What are the key properties of N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide?
N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide has a molecular weight of 380.43 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5H-chromeno[3,4-c]pyridin-8-yl)-4-methylsulfonylbenzamide is sourced from PubChem (CID 121363928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).