About 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea
1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea (PubChem CID 121363977) has the molecular formula C22H21N3O3
and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea.
Molecular Properties
| Compound Name | 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea |
| PubChem CID | 121363977 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(CCNC(=O)Nc2ccc3c(c2)OCc2cnccc2-3)cc1 |
| InChI | InChI=1S/C22H21N3O3/c1-27-18-5-2-15(3-6-18)8-11-24-22(26)25-17-4-7-20-19-9-10-23-13-16(19)14-28-21(20)12-17/h2-7,9-10,12-13H,8,11,14H2,1H3,(H2,24,25,26) |
| InChIKey | WNMJUYWTRVMPEQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea?
The IUPAC name of 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea (CID 121363977) is 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea.
What is the SMILES notation for 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea?
The canonical SMILES for 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea is COc1ccc(CCNC(=O)Nc2ccc3c(c2)OCc2cnccc2-3)cc1.
What is the InChIKey of 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea?
The InChIKey is WNMJUYWTRVMPEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O3/c1-27-18-5-2-15(3-6-18)8-11-24-22(26)25-17-4-7-20-19-9-10-23-13-16(19)14-28-21(20)12-17/h2-7,9-10,12-13H,8,11,14H2,1H3,(H2,24,25,26).
What are the key properties of 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea?
1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea has a molecular weight of 375.43 g/mol, XLogP of 4.01, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5H-chromeno[3,4-c]pyridin-8-yl)-3-[2-(4-methoxyphenyl)ethyl]urea is sourced from PubChem (CID 121363977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).