C24H27F4NO3S — CID 121364125
2-ethylhexyl 3-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfanylpropanoate (PubChem CID 121364125) has the molecular formula C24H27F4NO3S and a molecular weight of 485.54 g/mol. Its IUPAC name is 2-ethylhexyl 3-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfanylpropanoate.
| Compound Name | 2-ethylhexyl 3-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 121364125 |
| Molecular Formula | C24H27F4NO3S |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 2-ethylhexyl 3-[2-fluoro-5-[(3,4,5-trifluorophenyl)carbamoyl]phenyl]sulfanylpropanoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1F |
| InChI | InChI=1S/C24H27F4NO3S/c1-3-5-6-15(4-2)14-32-22(30)9-10-33-21-11-16(7-8-18(21)25)24(31)29-17-12-19(26)23(28)20(27)13-17/h7-8,11-13,15H,3-6,9-10,14H2,1-2H3,(H,29,31) |
| InChIKey | ZWNGBSPZFFTQRZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|