C28H36N8S2+2 — CID 121365169
N,N'-dimethyl-N,N'-bis[3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine (PubChem CID 121365169) has the molecular formula C28H36N8S2+2 and a molecular weight of 548.79 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis[3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine.
| Compound Name | N,N'-dimethyl-N,N'-bis[3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 121365169 |
| Molecular Formula | C28H36N8S2+2 |
| Molecular Weight | 548.79 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis[3-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine |
| SMILES | Cc1cc(N(C)CCCCN(C)c2ccc(/N=N/c3scc[n+]3C)c(C)c2)ccc1/N=N/c1scc[n+]1C |
| InChI | InChI=1S/C28H36N8S2/c1-21-19-23(9-11-25(21)29-31-27-35(5)15-17-37-27)33(3)13-7-8-14-34(4)24-10-12-26(22(2)20-24)30-32-28-36(6)16-18-38-28/h9-12,15-20H,7-8,13-14H2,1-6H3/q+2 |
| InChIKey | FXCLYWUCSCZMNC-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.79 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|