C27H38N12+2 — CID 121365173
N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-2-methylphenyl]-N,N'-dimethylpropane-1,3-diamine (PubChem CID 121365173) has the molecular formula C27H38N12+2 and a molecular weight of 530.69 g/mol. Its IUPAC name is N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-2-methylphenyl]-N,N'-dimethylpropane-1,3-diamine.
| Compound Name | N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-2-methylphenyl]-N,N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121365173 |
| Molecular Formula | C27H38N12+2 |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-2-methylphenyl]-N,N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1cc(/N=N/c2n(C)nc[n+]2C)ccc1N(C)CCCN(C)c1ccc(/N=N/c2n(C)nc[n+]2C)cc1C |
| InChI | InChI=1S/C27H38N12/c1-20-16-22(30-32-26-36(5)18-28-38(26)7)10-12-24(20)34(3)14-9-15-35(4)25-13-11-23(17-21(25)2)31-33-27-37(6)19-29-39(27)8/h10-13,16-19H,9,14-15H2,1-8H3/q+2 |
| InChIKey | UBPKQCGWEPNDJR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|