C27H38N12O2+2 — CID 121365192
N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-2-methoxyphenyl]pentane-1,5-diamine (PubChem CID 121365192) has the molecular formula C27H38N12O2+2 and a molecular weight of 562.68 g/mol. Its IUPAC name is N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-2-methoxyphenyl]pentane-1,5-diamine.
| Compound Name | N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-2-methoxyphenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 121365192 |
| Molecular Formula | C27H38N12O2+2 |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | N,N'-bis[4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-2-methoxyphenyl]pentane-1,5-diamine |
| SMILES | COc1cc(/N=N/c2n(C)nc[n+]2C)ccc1NCCCCCNc1ccc(/N=N/c2n(C)nc[n+]2C)cc1OC |
| InChI | InChI=1S/C27H36N12O2/c1-36-18-30-38(3)26(36)34-32-20-10-12-22(24(16-20)40-5)28-14-8-7-9-15-29-23-13-11-21(17-25(23)41-6)33-35-27-37(2)19-31-39(27)4/h10-13,16-19H,7-9,14-15H2,1-6H3/p+2 |
| InChIKey | DWFRIRHAKXRGER-UHFFFAOYSA-P |
| XLogP | 4.34 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|