C26H32N8O2S2+2 — CID 121365202
N,N'-bis[2-methoxy-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine (PubChem CID 121365202) has the molecular formula C26H32N8O2S2+2 and a molecular weight of 552.73 g/mol. Its IUPAC name is N,N'-bis[2-methoxy-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine.
| Compound Name | N,N'-bis[2-methoxy-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 121365202 |
| Molecular Formula | C26H32N8O2S2+2 |
| Molecular Weight | 552.73 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | N,N'-bis[2-methoxy-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]butane-1,4-diamine |
| SMILES | COc1cc(/N=N/c2scc[n+]2C)ccc1NCCCCNc1ccc(/N=N/c2scc[n+]2C)cc1OC |
| InChI | InChI=1S/C26H30N8O2S2/c1-33-13-15-37-25(33)31-29-19-7-9-21(23(17-19)35-3)27-11-5-6-12-28-22-10-8-20(18-24(22)36-4)30-32-26-34(2)14-16-38-26/h7-10,13-18H,5-6,11-12H2,1-4H3/p+2 |
| InChIKey | MLNVXKHYTJCLSF-UHFFFAOYSA-P |
| XLogP | 6.61 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.73 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|